About CID 159962191
CID 159962191 (PubChem CID 159962191) has the molecular formula C12H11NRb
and a molecular weight of 254.70 g/mol.
Molecular Properties
| Compound Name | CID 159962191 |
| PubChem CID | 159962191 |
| Molecular Formula | C12H11NRb |
| Molecular Weight | 254.70 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | — |
| SMILES | Nc1ccccc1-c1ccccc1.[Rb] |
| InChI | InChI=1S/C12H11N.Rb/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9H,13H2; |
| InChIKey | ODLZHTHAZOYJFN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.70 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze CID 159962191 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159962191?
The IUPAC name of CID 159962191 (CID 159962191) is not available.
What is the SMILES notation for CID 159962191?
The canonical SMILES for CID 159962191 is Nc1ccccc1-c1ccccc1.[Rb].
What is the InChIKey of CID 159962191?
The InChIKey is ODLZHTHAZOYJFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.Rb/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9H,13H2;.
What are the key properties of CID 159962191?
CID 159962191 has a molecular weight of 254.70 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159962191 is sourced from PubChem (CID 159962191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).