About 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde
4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde (PubChem CID 159962732) has the molecular formula C9H8N2O3S
and a molecular weight of 224.24 g/mol. Its IUPAC name is 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde |
| PubChem CID | 159962732 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde |
| SMILES | NC1=NS(=O)(=O)Cc2cccc(C=O)c21 |
| InChI | InChI=1S/C9H8N2O3S/c10-9-8-6(4-12)2-1-3-7(8)5-15(13,14)11-9/h1-4H,5H2,(H2,10,11) |
| InChIKey | XKSQOCNJTRQKLB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde?
The IUPAC name of 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde (CID 159962732) is 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde.
What is the SMILES notation for 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde?
The canonical SMILES for 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde is NC1=NS(=O)(=O)Cc2cccc(C=O)c21.
What is the InChIKey of 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde?
The InChIKey is XKSQOCNJTRQKLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3S/c10-9-8-6(4-12)2-1-3-7(8)5-15(13,14)11-9/h1-4H,5H2,(H2,10,11).
What are the key properties of 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde?
4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde has a molecular weight of 224.24 g/mol, XLogP of 0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,2-dioxo-1H-2λ6,3-benzothiazine-5-carbaldehyde is sourced from PubChem (CID 159962732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).