About 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane
2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane (PubChem CID 159963485) has the molecular formula C21H46N2
and a molecular weight of 326.61 g/mol. Its IUPAC name is 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane.
Molecular Properties
| Compound Name | 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane |
| PubChem CID | 159963485 |
| Molecular Formula | C21H46N2 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 326.37 |
| IUPAC Name | 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane |
| SMILES | C.C.C.CC1CC2CCC(C1)N2C.CC1CC2CCC1CN2C |
| InChI | InChI=1S/2C9H17N.3CH4/c1-7-5-9-4-3-8(7)6-10(9)2;1-7-5-8-3-4-9(6-7)10(8)2;;;/h2*7-9H,3-6H2,1-2H3;3*1H4 |
| InChIKey | ODPXHQNNGFHZQP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane?
The IUPAC name of 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane (CID 159963485) is 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane.
What is the SMILES notation for 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane?
The canonical SMILES for 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane is C.C.C.CC1CC2CCC(C1)N2C.CC1CC2CCC1CN2C.
What is the InChIKey of 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane?
The InChIKey is ODPXHQNNGFHZQP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H17N.3CH4/c1-7-5-9-4-3-8(7)6-10(9)2;1-7-5-8-3-4-9(6-7)10(8)2;;;/h2*7-9H,3-6H2,1-2H3;3*1H4.
What are the key properties of 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane?
2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane has a molecular weight of 326.61 g/mol, XLogP of 5.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-2-azabicyclo[2.2.2]octane;3,8-dimethyl-8-azabicyclo[3.2.1]octane;methane is sourced from PubChem (CID 159963485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).