About 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene
3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene (PubChem CID 159963940) has the molecular formula C20H34N2
and a molecular weight of 302.51 g/mol. Its IUPAC name is 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene.
Molecular Properties
| Compound Name | 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene |
| PubChem CID | 159963940 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene |
| SMILES | C1=CCCCC(C2=CCCCCCCCCC2)=NNCCC1 |
| InChI | InChI=1S/C20H34N2/c1-2-4-8-12-16-19(15-11-7-3-1)20-17-13-9-5-6-10-14-18-21-22-20/h5-6,15,21H,1-4,7-14,16-18H2 |
| InChIKey | ODRJZSKGIONICO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene?
The IUPAC name of 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene (CID 159963940) is 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene.
What is the SMILES notation for 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene?
The canonical SMILES for 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene is C1=CCCCC(C2=CCCCCCCCCC2)=NNCCC1.
What is the InChIKey of 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene?
The InChIKey is ODRJZSKGIONICO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34N2/c1-2-4-8-12-16-19(15-11-7-3-1)20-17-13-9-5-6-10-14-18-21-22-20/h5-6,15,21H,1-4,7-14,16-18H2.
What are the key properties of 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene?
3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene has a molecular weight of 302.51 g/mol, XLogP of 5.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cycloundecen-1-yl)-1,2-diazacycloundeca-2,7-diene is sourced from PubChem (CID 159963940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).