About N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide
N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide (PubChem CID 159964166) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide |
| PubChem CID | 159964166 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide |
| SMILES | CC/C=C(\C=C1\C=CN=CC1)NC(C)=O |
| InChI | InChI=1S/C12H16N2O/c1-3-4-12(14-10(2)15)9-11-5-7-13-8-6-11/h4-5,7-9H,3,6H2,1-2H3,(H,14,15)/b11-9-,12-4+ |
| InChIKey | ODSCYJJEGOWXJH-PAPFAYTFSA-N |
| XLogP | 2.33 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide?
The IUPAC name of N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide (CID 159964166) is N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide.
What is the SMILES notation for N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide?
The canonical SMILES for N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide is CC/C=C(\C=C1\C=CN=CC1)NC(C)=O.
What is the InChIKey of N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide?
The InChIKey is ODSCYJJEGOWXJH-PAPFAYTFSA-N. The full InChI is InChI=1S/C12H16N2O/c1-3-4-12(14-10(2)15)9-11-5-7-13-8-6-11/h4-5,7-9H,3,6H2,1-2H3,(H,14,15)/b11-9-,12-4+.
What are the key properties of N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide?
N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide has a molecular weight of 204.27 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E,1E)-1-(3H-pyridin-4-ylidene)pent-2-en-2-yl]acetamide is sourced from PubChem (CID 159964166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).