About 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole
5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole (PubChem CID 159964894) has the molecular formula C17H18N8O
and a molecular weight of 350.39 g/mol. Its IUPAC name is 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole.
Molecular Properties
| Compound Name | 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole |
| PubChem CID | 159964894 |
| Molecular Formula | C17H18N8O |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole |
| SMILES | COCc1ccc(-c2nn[nH]n2)cc1.Cc1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C9H10N4O.C8H8N4/c1-14-6-7-2-4-8(5-3-7)9-10-12-13-11-9;1-6-2-4-7(5-3-6)8-9-11-12-10-8/h2-5H,6H2,1H3,(H,10,11,12,13);2-5H,1H3,(H,9,10,11,12) |
| InChIKey | ODUPIMUNSSDDHV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole?
The IUPAC name of 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole (CID 159964894) is 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole.
What is the SMILES notation for 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole?
The canonical SMILES for 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole is COCc1ccc(-c2nn[nH]n2)cc1.Cc1ccc(-c2nn[nH]n2)cc1.
What is the InChIKey of 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole?
The InChIKey is ODUPIMUNSSDDHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O.C8H8N4/c1-14-6-7-2-4-8(5-3-7)9-10-12-13-11-9;1-6-2-4-7(5-3-6)8-9-11-12-10-8/h2-5H,6H2,1H3,(H,10,11,12,13);2-5H,1H3,(H,9,10,11,12).
What are the key properties of 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole?
5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole has a molecular weight of 350.39 g/mol, XLogP of 2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(methoxymethyl)phenyl]-2H-tetrazole;5-(4-methylphenyl)-2H-tetrazole is sourced from PubChem (CID 159964894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).