C15H22BN2O8V- — CID 159965025
2-[2-[3-(4-acetyl-4-aminopyrrolidin-1-id-3-yl)propyl]-4-(formyloxymethyl)-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid;vanadium (PubChem CID 159965025) has the molecular formula C15H22BN2O8V- and a molecular weight of 420.10 g/mol. Its IUPAC name is 2-[2-[3-(4-acetyl-4-aminopyrrolidin-1-id-3-yl)propyl]-4-(formyloxymethyl)-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid;vanadium.
| Compound Name | 2-[2-[3-(4-acetyl-4-aminopyrrolidin-1-id-3-yl)propyl]-4-(formyloxymethyl)-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid;vanadium |
|---|---|
| PubChem CID | 159965025 |
| Molecular Formula | C15H22BN2O8V- |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-[2-[3-(4-acetyl-4-aminopyrrolidin-1-id-3-yl)propyl]-4-(formyloxymethyl)-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid;vanadium |
| SMILES | CC(=O)C1(N)C[N-]CC1CCCB1OC(=O)C(COC=O)(CC(=O)O)O1.[V] |
| InChI | InChI=1S/C15H22BN2O8.V/c1-10(20)15(17)7-18-6-11(15)3-2-4-16-25-13(23)14(26-16,5-12(21)22)8-24-9-19;/h9,11H,2-8,17H2,1H3,(H,21,22);/q-1; |
| InChIKey | FKMZKIPJNBTZKO-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 156.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|