About N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide
N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide (PubChem CID 159966588) has the molecular formula C10H15N5
and a molecular weight of 205.26 g/mol. Its IUPAC name is N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide.
Molecular Properties
| Compound Name | N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide |
| PubChem CID | 159966588 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide |
| SMILES | CNC(C#N)=C(C#N)/C(N)=N/C(C)(C)C |
| InChI | InChI=1S/C10H15N5/c1-10(2,3)15-9(13)7(5-11)8(6-12)14-4/h14H,1-4H3,(H2,13,15) |
| InChIKey | UVJLVVLNGQZNEF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide?
The IUPAC name of N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide (CID 159966588) is N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide.
What is the SMILES notation for N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide?
The canonical SMILES for N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide is CNC(C#N)=C(C#N)/C(N)=N/C(C)(C)C.
What is the InChIKey of N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide?
The InChIKey is UVJLVVLNGQZNEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5/c1-10(2,3)15-9(13)7(5-11)8(6-12)14-4/h14H,1-4H3,(H2,13,15).
What are the key properties of N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide?
N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide has a molecular weight of 205.26 g/mol, XLogP of 0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-2,3-dicyano-3-(methylamino)prop-2-enimidamide is sourced from PubChem (CID 159966588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).