C22H20N2O3 — CID 15996824
7-methoxy-N-[2-(3-methylphenyl)ethyl]furo[2,3-b]quinoline-2-carboxamide (PubChem CID 15996824) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 7-methoxy-N-[2-(3-methylphenyl)ethyl]furo[2,3-b]quinoline-2-carboxamide.
| Compound Name | 7-methoxy-N-[2-(3-methylphenyl)ethyl]furo[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 15996824 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 7-methoxy-N-[2-(3-methylphenyl)ethyl]furo[2,3-b]quinoline-2-carboxamide |
| SMILES | COc1ccc2cc3cc(C(=O)NCCc4cccc(C)c4)oc3nc2c1 |
| InChI | InChI=1S/C22H20N2O3/c1-14-4-3-5-15(10-14)8-9-23-21(25)20-12-17-11-16-6-7-18(26-2)13-19(16)24-22(17)27-20/h3-7,10-13H,8-9H2,1-2H3,(H,23,25) |
| InChIKey | NCKNIAADTYKOCG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |