C25H33N5OS — CID 15997097
N-(2,3-dimethylcyclohexyl)-2-[[5,7-dimethyl-6-[(2-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 15997097) has the molecular formula C25H33N5OS and a molecular weight of 451.64 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-2-[[5,7-dimethyl-6-[(2-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-2-[[5,7-dimethyl-6-[(2-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 15997097 |
| Molecular Formula | C25H33N5OS |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-2-[[5,7-dimethyl-6-[(2-methylphenyl)methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | Cc1ccccc1Cc1c(C)nc2nc(SCC(=O)NC3CCCC(C)C3C)nn2c1C |
| InChI | InChI=1S/C25H33N5OS/c1-15-10-8-12-22(17(15)3)27-23(31)14-32-25-28-24-26-18(4)21(19(5)30(24)29-25)13-20-11-7-6-9-16(20)2/h6-7,9,11,15,17,22H,8,10,12-14H2,1-5H3,(H,27,31) |
| InChIKey | VDAZCMKQBIWXJV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |