C41H55Cl2N2PRu — CID 159971004
[3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-1,4-dichloro-2-(3-methylbut-2-enylidene)cyclopentyl]-dicyclopentylphosphane;ruthenium (PubChem CID 159971004) has the molecular formula C41H55Cl2N2PRu and a molecular weight of 778.86 g/mol. Its IUPAC name is [3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-1,4-dichloro-2-(3-methylbut-2-enylidene)cyclopentyl]-dicyclopentylphosphane;ruthenium.
| Compound Name | [3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-1,4-dichloro-2-(3-methylbut-2-enylidene)cyclopentyl]-dicyclopentylphosphane;ruthenium |
|---|---|
| PubChem CID | 159971004 |
| Molecular Formula | C41H55Cl2N2PRu |
| Molecular Weight | 778.86 g/mol |
| Exact Mass | 778.25 |
| IUPAC Name | [3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-1,4-dichloro-2-(3-methylbut-2-enylidene)cyclopentyl]-dicyclopentylphosphane;ruthenium |
| SMILES | CC(C)=CC=C1C(=C2N(c3c(C)cc(C)cc3C)CCN2c2c(C)cc(C)cc2C)C(Cl)CC1(Cl)P(C1CCCC1)C1CCCC1.[Ru] |
| InChI | InChI=1S/C41H55Cl2N2P.Ru/c1-26(2)17-18-35-37(36(42)25-41(35,43)46(33-13-9-10-14-33)34-15-11-12-16-34)40-44(38-29(5)21-27(3)22-30(38)6)19-20-45(40)39-31(7)23-28(4)24-32(39)8;/h17-18,21-24,33-34,36H,9-16,19-20,25H2,1-8H3; |
| InChIKey | OENVOMQGQOCHPR-UHFFFAOYSA-N |
| XLogP | 12.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.86 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|