About N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide
N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 159971524) has the molecular formula C17H18N2O5S
and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 159971524 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1cc(C=CC(=O)c2sc(NC(C)=O)nc2C)cc(OC)c1O |
| InChI | InChI=1S/C17H18N2O5S/c1-9-16(25-17(18-9)19-10(2)20)12(21)6-5-11-7-13(23-3)15(22)14(8-11)24-4/h5-8,22H,1-4H3,(H,18,19,20) |
| InChIKey | OEPKUDLSNBRIDI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide (CID 159971524) is N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide is COc1cc(C=CC(=O)c2sc(NC(C)=O)nc2C)cc(OC)c1O.
What is the InChIKey of N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide?
The InChIKey is OEPKUDLSNBRIDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O5S/c1-9-16(25-17(18-9)19-10(2)20)12(21)6-5-11-7-13(23-3)15(22)14(8-11)24-4/h5-8,22H,1-4H3,(H,18,19,20).
What are the key properties of N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide?
N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide has a molecular weight of 362.41 g/mol, XLogP of 3.03, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-4-methyl-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 159971524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).