About CID 159973037
CID 159973037 (PubChem CID 159973037) has the molecular formula C13H15N5NaO3S
and a molecular weight of 344.35 g/mol.
Molecular Properties
| Compound Name | CID 159973037 |
| PubChem CID | 159973037 |
| Molecular Formula | C13H15N5NaO3S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | — |
| SMILES | CCC(=O)NS(=O)(=O)c1ccc(-c2cnc(N)nc2N)cc1.[Na] |
| InChI | InChI=1S/C13H15N5O3S.Na/c1-2-11(19)18-22(20,21)9-5-3-8(4-6-9)10-7-16-13(15)17-12(10)14;/h3-7H,2H2,1H3,(H,18,19)(H4,14,15,16,17); |
| InChIKey | OEULUJWKQNZSNI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 159973037 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159973037?
The IUPAC name of CID 159973037 (CID 159973037) is not available.
What is the SMILES notation for CID 159973037?
The canonical SMILES for CID 159973037 is CCC(=O)NS(=O)(=O)c1ccc(-c2cnc(N)nc2N)cc1.[Na].
What is the InChIKey of CID 159973037?
The InChIKey is OEULUJWKQNZSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O3S.Na/c1-2-11(19)18-22(20,21)9-5-3-8(4-6-9)10-7-16-13(15)17-12(10)14;/h3-7H,2H2,1H3,(H,18,19)(H4,14,15,16,17);.
What are the key properties of CID 159973037?
CID 159973037 has a molecular weight of 344.35 g/mol, XLogP of 0.14, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159973037 is sourced from PubChem (CID 159973037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).