C27H42N4O — CID 159973400
N,1-dimethyl-N-[[4-[3-[4-(3H-pyrrol-5-ylmethyl)piperidin-1-yl]propoxy]phenyl]methyl]piperidin-4-amine (PubChem CID 159973400) has the molecular formula C27H42N4O and a molecular weight of 438.66 g/mol. Its IUPAC name is N,1-dimethyl-N-[[4-[3-[4-(3H-pyrrol-5-ylmethyl)piperidin-1-yl]propoxy]phenyl]methyl]piperidin-4-amine.
| Compound Name | N,1-dimethyl-N-[[4-[3-[4-(3H-pyrrol-5-ylmethyl)piperidin-1-yl]propoxy]phenyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 159973400 |
| Molecular Formula | C27H42N4O |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.34 |
| IUPAC Name | N,1-dimethyl-N-[[4-[3-[4-(3H-pyrrol-5-ylmethyl)piperidin-1-yl]propoxy]phenyl]methyl]piperidin-4-amine |
| SMILES | CN1CCC(N(C)Cc2ccc(OCCCN3CCC(CC4=CCC=N4)CC3)cc2)CC1 |
| InChI | InChI=1S/C27H42N4O/c1-29-16-12-26(13-17-29)30(2)22-24-6-8-27(9-7-24)32-20-4-15-31-18-10-23(11-19-31)21-25-5-3-14-28-25/h5-9,14,23,26H,3-4,10-13,15-22H2,1-2H3 |
| InChIKey | JWIDNRBSRLZJEY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 31.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|