C10H20N4O7 — CID 159974342
1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione;1,3-bis(hydroxymethyl)urea (PubChem CID 159974342) has the molecular formula C10H20N4O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is 1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione;1,3-bis(hydroxymethyl)urea.
| Compound Name | 1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione;1,3-bis(hydroxymethyl)urea |
|---|---|
| PubChem CID | 159974342 |
| Molecular Formula | C10H20N4O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1,3-bis(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione;1,3-bis(hydroxymethyl)urea |
| SMILES | CC1(C)C(=O)N(CO)C(=O)N1CO.O=C(NCO)NCO |
| InChI | InChI=1S/C7H12N2O4.C3H8N2O3/c1-7(2)5(12)8(3-10)6(13)9(7)4-11;6-1-4-3(8)5-2-7/h10-11H,3-4H2,1-2H3;6-7H,1-2H2,(H2,4,5,8) |
| InChIKey | OEYMRVMEDFEENH-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 162.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|