About N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide
N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide (PubChem CID 15997479) has the molecular formula C11H12N4O2
and a molecular weight of 232.24 g/mol. Its IUPAC name is N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide.
Molecular Properties
| Compound Name | N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide |
| PubChem CID | 15997479 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide |
| SMILES | CCC(=O)N/C(N)=N/c1nc2ccccc2o1 |
| InChI | InChI=1S/C11H12N4O2/c1-2-9(16)14-10(12)15-11-13-7-5-3-4-6-8(7)17-11/h3-6H,2H2,1H3,(H3,12,13,14,15,16) |
| InChIKey | QBGCZMGFODIOGS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide?
The IUPAC name of N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide (CID 15997479) is N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide.
What is the SMILES notation for N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide?
The canonical SMILES for N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide is CCC(=O)N/C(N)=N/c1nc2ccccc2o1.
What is the InChIKey of N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide?
The InChIKey is QBGCZMGFODIOGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c1-2-9(16)14-10(12)15-11-13-7-5-3-4-6-8(7)17-11/h3-6H,2H2,1H3,(H3,12,13,14,15,16).
What are the key properties of N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide?
N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide has a molecular weight of 232.24 g/mol, XLogP of 1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-N'-(1,3-benzoxazol-2-yl)carbamimidoyl]propanamide is sourced from PubChem (CID 15997479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).