C21H24N2 — CID 159975245
3-(2-methylphenyl)butanenitrile;3-(2-methylphenyl)propanenitrile (PubChem CID 159975245) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 3-(2-methylphenyl)butanenitrile;3-(2-methylphenyl)propanenitrile.
| Compound Name | 3-(2-methylphenyl)butanenitrile;3-(2-methylphenyl)propanenitrile |
|---|---|
| PubChem CID | 159975245 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 3-(2-methylphenyl)butanenitrile;3-(2-methylphenyl)propanenitrile |
| SMILES | Cc1ccccc1C(C)CC#N.Cc1ccccc1CCC#N |
| InChI | InChI=1S/C11H13N.C10H11N/c1-9-5-3-4-6-11(9)10(2)7-8-12;1-9-5-2-3-6-10(9)7-4-8-11/h3-6,10H,7H2,1-2H3;2-3,5-6H,4,7H2,1H3 |
| InChIKey | OFBLNHVENFNXAE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |