About 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide
1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide (PubChem CID 159975353) has the molecular formula C15H30N2O3S
and a molecular weight of 318.48 g/mol. Its IUPAC name is 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide.
Molecular Properties
| Compound Name | 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide |
| PubChem CID | 159975353 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide |
| SMILES | CC(C)(C)N1CCCC1=O.CC(C)(C)N1CCCS1(=O)=O |
| InChI | InChI=1S/C8H15NO.C7H15NO2S/c1-8(2,3)9-6-4-5-7(9)10;1-7(2,3)8-5-4-6-11(8,9)10/h4-6H2,1-3H3;4-6H2,1-3H3 |
| InChIKey | OFBUKSBLFMMRMP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide?
The IUPAC name of 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide (CID 159975353) is 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide.
What is the SMILES notation for 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide?
The canonical SMILES for 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide is CC(C)(C)N1CCCC1=O.CC(C)(C)N1CCCS1(=O)=O.
What is the InChIKey of 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide?
The InChIKey is OFBUKSBLFMMRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.C7H15NO2S/c1-8(2,3)9-6-4-5-7(9)10;1-7(2,3)8-5-4-6-11(8,9)10/h4-6H2,1-3H3;4-6H2,1-3H3.
What are the key properties of 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide?
1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide has a molecular weight of 318.48 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylpyrrolidin-2-one;2-tert-butyl-1,2-thiazolidine 1,1-dioxide is sourced from PubChem (CID 159975353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).