About N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide
N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide (PubChem CID 15997545) has the molecular formula C20H26N2O4
and a molecular weight of 358.44 g/mol. Its IUPAC name is N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide |
| PubChem CID | 15997545 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide |
| SMILES | COc1cc2c(C(=O)N(C)C3CCCCC3)cn(C)c(=O)c2cc1OC |
| InChI | InChI=1S/C20H26N2O4/c1-21-12-16(20(24)22(2)13-8-6-5-7-9-13)14-10-17(25-3)18(26-4)11-15(14)19(21)23/h10-13H,5-9H2,1-4H3 |
| InChIKey | QUXSVUSGGZWXAT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide?
The IUPAC name of N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide (CID 15997545) is N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide.
What is the SMILES notation for N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide?
The canonical SMILES for N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide is COc1cc2c(C(=O)N(C)C3CCCCC3)cn(C)c(=O)c2cc1OC.
What is the InChIKey of N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide?
The InChIKey is QUXSVUSGGZWXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O4/c1-21-12-16(20(24)22(2)13-8-6-5-7-9-13)14-10-17(25-3)18(26-4)11-15(14)19(21)23/h10-13H,5-9H2,1-4H3.
What are the key properties of N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide?
N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide has a molecular weight of 358.44 g/mol, XLogP of 2.96, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-6,7-dimethoxy-N,2-dimethyl-1-oxoisoquinoline-4-carboxamide is sourced from PubChem (CID 15997545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).