About 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide
3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide (PubChem CID 15997792) has the molecular formula C20H21FN2O4S
and a molecular weight of 404.46 g/mol. Its IUPAC name is 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide.
Molecular Properties
| Compound Name | 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide |
| PubChem CID | 15997792 |
| Molecular Formula | C20H21FN2O4S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)CCC(=O)NCc3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C20H21FN2O4S/c1-14(24)23-10-8-16-12-18(6-7-19(16)23)28(26,27)11-9-20(25)22-13-15-2-4-17(21)5-3-15/h2-7,12H,8-11,13H2,1H3,(H,22,25) |
| InChIKey | ZXDNEZYDLMCUAT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide?
The IUPAC name of 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide (CID 15997792) is 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide.
What is the SMILES notation for 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide?
The canonical SMILES for 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide is CC(=O)N1CCc2cc(S(=O)(=O)CCC(=O)NCc3ccc(F)cc3)ccc21.
What is the InChIKey of 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide?
The InChIKey is ZXDNEZYDLMCUAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN2O4S/c1-14(24)23-10-8-16-12-18(6-7-19(16)23)28(26,27)11-9-20(25)22-13-15-2-4-17(21)5-3-15/h2-7,12H,8-11,13H2,1H3,(H,22,25).
What are the key properties of 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide?
3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide has a molecular weight of 404.46 g/mol, XLogP of 2.21, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-acetyl-2,3-dihydroindol-5-yl)sulfonyl]-N-[(4-fluorophenyl)methyl]propanamide is sourced from PubChem (CID 15997792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).