About N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid
N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid (PubChem CID 159978031) has the molecular formula C10H16ClNO3
and a molecular weight of 233.69 g/mol. Its IUPAC name is N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid.
Molecular Properties
| Compound Name | N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid |
| PubChem CID | 159978031 |
| Molecular Formula | C10H16ClNO3 |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid |
| SMILES | O=C(O)C1CC1.ON=C1CCCCC1Cl |
| InChI | InChI=1S/C6H10ClNO.C4H6O2/c7-5-3-1-2-4-6(5)8-9;5-4(6)3-1-2-3/h5,9H,1-4H2;3H,1-2H2,(H,5,6) |
| InChIKey | OFKGMPQDIOFLLR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid?
The IUPAC name of N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid (CID 159978031) is N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid.
What is the SMILES notation for N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid?
The canonical SMILES for N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid is O=C(O)C1CC1.ON=C1CCCCC1Cl.
What is the InChIKey of N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid?
The InChIKey is OFKGMPQDIOFLLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10ClNO.C4H6O2/c7-5-3-1-2-4-6(5)8-9;5-4(6)3-1-2-3/h5,9H,1-4H2;3H,1-2H2,(H,5,6).
What are the key properties of N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid?
N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid has a molecular weight of 233.69 g/mol, XLogP of 2.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorocyclohexylidene)hydroxylamine;cyclopropanecarboxylic acid is sourced from PubChem (CID 159978031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).