C23H25BF2N2O3 — CID 159978367
4-fluorobenzonitrile;2-(2-fluoro-5-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane;oxolane (PubChem CID 159978367) has the molecular formula C23H25BF2N2O3 and a molecular weight of 426.27 g/mol. Its IUPAC name is 4-fluorobenzonitrile;2-(2-fluoro-5-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane;oxolane.
| Compound Name | 4-fluorobenzonitrile;2-(2-fluoro-5-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane;oxolane |
|---|---|
| PubChem CID | 159978367 |
| Molecular Formula | C23H25BF2N2O3 |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 4-fluorobenzonitrile;2-(2-fluoro-5-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane;oxolane |
| SMILES | C1CCOC1.N#Cc1ccc(F)cc1.[C-]#[N+]c1ccc(F)c(B2OCC(C)(C)CO2)c1 |
| InChI | InChI=1S/C12H13BFNO2.C7H4FN.C4H8O/c1-12(2)7-16-13(17-8-12)10-6-9(15-3)4-5-11(10)14;8-7-3-1-6(5-9)2-4-7;1-2-4-5-3-1/h4-6H,7-8H2,1-2H3;1-4H;1-4H2 |
| InChIKey | OFLHXYKSXMWKNC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|