C25H23ClF2N4O2 — CID 159978556
3-[6-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridin-3-yl]propan-1-ol (PubChem CID 159978556) has the molecular formula C25H23ClF2N4O2 and a molecular weight of 484.93 g/mol. Its IUPAC name is 3-[6-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridin-3-yl]propan-1-ol.
| Compound Name | 3-[6-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridin-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 159978556 |
| Molecular Formula | C25H23ClF2N4O2 |
| Molecular Weight | 484.93 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 3-[6-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridin-3-yl]propan-1-ol |
| SMILES | OCCCc1cnc2ccc(-c3cn(C4CCCCO4)nc3-c3cc(Cl)c(F)cc3F)nc2c1 |
| InChI | InChI=1S/C25H23ClF2N4O2/c26-18-11-16(19(27)12-20(18)28)25-17(14-32(31-25)24-5-1-2-9-34-24)21-6-7-22-23(30-21)10-15(13-29-22)4-3-8-33/h6-7,10-14,24,33H,1-5,8-9H2 |
| InChIKey | FAPJEUDEVVZAGJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.93 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|