C26H25ClF2N4O — CID 159978557
7-butyl-2-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine (PubChem CID 159978557) has the molecular formula C26H25ClF2N4O and a molecular weight of 482.96 g/mol. Its IUPAC name is 7-butyl-2-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine.
| Compound Name | 7-butyl-2-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine |
|---|---|
| PubChem CID | 159978557 |
| Molecular Formula | C26H25ClF2N4O |
| Molecular Weight | 482.96 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 7-butyl-2-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine |
| SMILES | CCCCc1cnc2ccc(-c3cn(C4CCCCO4)nc3-c3cc(Cl)c(F)cc3F)nc2c1 |
| InChI | InChI=1S/C26H25ClF2N4O/c1-2-3-6-16-11-24-23(30-14-16)9-8-22(31-24)18-15-33(25-7-4-5-10-34-25)32-26(18)17-12-19(27)21(29)13-20(17)28/h8-9,11-15,25H,2-7,10H2,1H3 |
| InChIKey | MNAFZYMYTIMYBC-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.96 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|