C23H20N4O — CID 159978818
6-ethynyl-N-(5-methyl-2-pyridin-2-ylpyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide (PubChem CID 159978818) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is 6-ethynyl-N-(5-methyl-2-pyridin-2-ylpyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide.
| Compound Name | 6-ethynyl-N-(5-methyl-2-pyridin-2-ylpyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 159978818 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 6-ethynyl-N-(5-methyl-2-pyridin-2-ylpyrimidin-4-yl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| SMILES | C#Cc1ccc2c(c1)CCCC2C(=O)Nc1nc(-c2ccccn2)ncc1C |
| InChI | InChI=1S/C23H20N4O/c1-3-16-10-11-18-17(13-16)7-6-8-19(18)23(28)27-21-15(2)14-25-22(26-21)20-9-4-5-12-24-20/h1,4-5,9-14,19H,6-8H2,2H3,(H,25,26,27,28) |
| InChIKey | YTYOPOVDHKTVDQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|