C19H28O3S — CID 159978891
(1R,3aS,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ol (PubChem CID 159978891) has the molecular formula C19H28O3S and a molecular weight of 336.50 g/mol. Its IUPAC name is (1R,3aS,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ol.
| Compound Name | (1R,3aS,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ol |
|---|---|
| PubChem CID | 159978891 |
| Molecular Formula | C19H28O3S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (1R,3aS,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ol |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)[C@]1(O)CC[C@@H]2CCCC[C@]21C |
| InChI | InChI=1S/C19H28O3S/c1-15(14-23(21,22)17-9-4-3-5-10-17)19(20)13-11-16-8-6-7-12-18(16,19)2/h3-5,9-10,15-16,20H,6-8,11-14H2,1-2H3/t15-,16+,18-,19-/m1/s1 |
| InChIKey | OFMWMMVESAYBMT-UKBAYJJMSA-N |
| XLogP | 3.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |