About 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide
5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 15997896) has the molecular formula C20H17FN2O3S2
and a molecular weight of 416.50 g/mol. Its IUPAC name is 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide.
Molecular Properties
| Compound Name | 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide |
| PubChem CID | 15997896 |
| Molecular Formula | C20H17FN2O3S2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1cccs1)c1cc(S(=O)(=O)N2CCc3ccccc32)ccc1F |
| InChI | InChI=1S/C20H17FN2O3S2/c21-18-8-7-16(12-17(18)20(24)22-13-15-5-3-11-27-15)28(25,26)23-10-9-14-4-1-2-6-19(14)23/h1-8,11-12H,9-10,13H2,(H,22,24) |
| InChIKey | DYCOKVCQABFVBO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide?
The IUPAC name of 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide (CID 15997896) is 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide.
What is the SMILES notation for 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide?
The canonical SMILES for 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide is O=C(NCc1cccs1)c1cc(S(=O)(=O)N2CCc3ccccc32)ccc1F.
What is the InChIKey of 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide?
The InChIKey is DYCOKVCQABFVBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17FN2O3S2/c21-18-8-7-16(12-17(18)20(24)22-13-15-5-3-11-27-15)28(25,26)23-10-9-14-4-1-2-6-19(14)23/h1-8,11-12H,9-10,13H2,(H,22,24).
What are the key properties of 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide?
5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide has a molecular weight of 416.50 g/mol, XLogP of 3.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydroindol-1-ylsulfonyl)-2-fluoro-N-(thiophen-2-ylmethyl)benzamide is sourced from PubChem (CID 15997896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).