C26H24FNO2 — CID 15998024
10-(4-fluorophenyl)-9-(4-methylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 15998024) has the molecular formula C26H24FNO2 and a molecular weight of 401.48 g/mol. Its IUPAC name is 10-(4-fluorophenyl)-9-(4-methylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(4-fluorophenyl)-9-(4-methylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 15998024 |
| Molecular Formula | C26H24FNO2 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 10-(4-fluorophenyl)-9-(4-methylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | Cc1ccc(C2C3=C(CCCC3=O)N(c3ccc(F)cc3)C3=C2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C26H24FNO2/c1-16-8-10-17(11-9-16)24-25-20(4-2-6-22(25)29)28(19-14-12-18(27)13-15-19)21-5-3-7-23(30)26(21)24/h8-15,24H,2-7H2,1H3 |
| InChIKey | NJUHFJNHINJIBT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |