About 4-bromo-5-fluoro-2,1,3-benzothiadiazole
4-bromo-5-fluoro-2,1,3-benzothiadiazole (PubChem CID 159980541) has the molecular formula C6H2BrFN2S
and a molecular weight of 233.06 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 4-bromo-5-fluoro-2,1,3-benzothiadiazole |
| PubChem CID | 159980541 |
| Molecular Formula | C6H2BrFN2S |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.91 |
| IUPAC Name | 4-bromo-5-fluoro-2,1,3-benzothiadiazole |
| SMILES | Fc1ccc2nsnc2c1Br |
| InChI | InChI=1S/C6H2BrFN2S/c7-5-3(8)1-2-4-6(5)10-11-9-4/h1-2H |
| InChIKey | OFSBXFDINAWOPC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-5-fluoro-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-fluoro-2,1,3-benzothiadiazole?
The IUPAC name of 4-bromo-5-fluoro-2,1,3-benzothiadiazole (CID 159980541) is 4-bromo-5-fluoro-2,1,3-benzothiadiazole.
What is the SMILES notation for 4-bromo-5-fluoro-2,1,3-benzothiadiazole?
The canonical SMILES for 4-bromo-5-fluoro-2,1,3-benzothiadiazole is Fc1ccc2nsnc2c1Br.
What is the InChIKey of 4-bromo-5-fluoro-2,1,3-benzothiadiazole?
The InChIKey is OFSBXFDINAWOPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrFN2S/c7-5-3(8)1-2-4-6(5)10-11-9-4/h1-2H.
What are the key properties of 4-bromo-5-fluoro-2,1,3-benzothiadiazole?
4-bromo-5-fluoro-2,1,3-benzothiadiazole has a molecular weight of 233.06 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-fluoro-2,1,3-benzothiadiazole is sourced from PubChem (CID 159980541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).