About N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide
N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide (PubChem CID 159980594) has the molecular formula C7H9F3N2O2S
and a molecular weight of 242.22 g/mol. Its IUPAC name is N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide.
Molecular Properties
| Compound Name | N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide |
| PubChem CID | 159980594 |
| Molecular Formula | C7H9F3N2O2S |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cc[nH]c1)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N2O2S/c1-5(7(8,9)10)12-15(13,14)6-2-3-11-4-6/h2-5,11-12H,1H3/t5-/m1/s1 |
| InChIKey | OFSHTFZQIFWDJH-RXMQYKEDSA-N |
| XLogP | 1.24 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide?
The IUPAC name of N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide (CID 159980594) is N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide.
What is the SMILES notation for N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide?
The canonical SMILES for N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide is C[C@@H](NS(=O)(=O)c1cc[nH]c1)C(F)(F)F.
What is the InChIKey of N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide?
The InChIKey is OFSHTFZQIFWDJH-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H9F3N2O2S/c1-5(7(8,9)10)12-15(13,14)6-2-3-11-4-6/h2-5,11-12H,1H3/t5-/m1/s1.
What are the key properties of N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide?
N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide has a molecular weight of 242.22 g/mol, XLogP of 1.24, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-1,1,1-trifluoropropan-2-yl]-1H-pyrrole-3-sulfonamide is sourced from PubChem (CID 159980594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).