C21H37NO — CID 159982205
1,3,4,5,6-penta(propan-2-yl)-2H-azepin-7-one (PubChem CID 159982205) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is 1,3,4,5,6-penta(propan-2-yl)-2H-azepin-7-one.
| Compound Name | 1,3,4,5,6-penta(propan-2-yl)-2H-azepin-7-one |
|---|---|
| PubChem CID | 159982205 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | 1,3,4,5,6-penta(propan-2-yl)-2H-azepin-7-one |
| SMILES | CC(C)C1=C(C(C)C)C(C(C)C)=C(C(C)C)C(=O)N(C(C)C)C1 |
| InChI | InChI=1S/C21H37NO/c1-12(2)17-11-22(16(9)10)21(23)20(15(7)8)19(14(5)6)18(17)13(3)4/h12-16H,11H2,1-10H3 |
| InChIKey | PJLZUTMQUPNNBN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |