C25H17F5N4O — CID 159983520
(E)-3-[2-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-isoquinolin-4-ylprop-2-enamide (PubChem CID 159983520) has the molecular formula C25H17F5N4O and a molecular weight of 484.43 g/mol. Its IUPAC name is (E)-3-[2-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-isoquinolin-4-ylprop-2-enamide.
| Compound Name | (E)-3-[2-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-isoquinolin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 159983520 |
| Molecular Formula | C25H17F5N4O |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (E)-3-[2-[3-(1,1-difluoroethyl)-5-(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-isoquinolin-4-ylprop-2-enamide |
| SMILES | CC(F)(F)c1cc(-c2nccc(/C=C(/C(N)=O)c3cncc4ccccc34)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H17F5N4O/c1-24(26,27)16-8-15(9-17(10-16)25(28,29)30)23-33-7-6-18(34-23)11-20(22(31)35)21-13-32-12-14-4-2-3-5-19(14)21/h2-13H,1H3,(H2,31,35)/b20-11+ |
| InChIKey | ZLNYSDBHLGGAGK-RGVLZGJSSA-N |
| XLogP | 5.85 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|