About diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate
diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate (PubChem CID 159983761) has the molecular formula C22H38O11
and a molecular weight of 478.54 g/mol. Its IUPAC name is diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate.
Molecular Properties
| Compound Name | diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate |
| PubChem CID | 159983761 |
| Molecular Formula | C22H38O11 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate |
| SMILES | CCCC(=O)OCC.CCOC(=O)C(=O)C(CC)C(=O)OCC.CCOC(=O)C(=O)OCC |
| InChI | InChI=1S/C10H16O5.C6H10O4.C6H12O2/c1-4-7(9(12)14-5-2)8(11)10(13)15-6-3;1-3-9-5(7)6(8)10-4-2;1-3-5-6(7)8-4-2/h7H,4-6H2,1-3H3;3-4H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | OGBMMVFUNOWTKO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate?
The IUPAC name of diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate (CID 159983761) is diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate.
What is the SMILES notation for diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate?
The canonical SMILES for diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate is CCCC(=O)OCC.CCOC(=O)C(=O)C(CC)C(=O)OCC.CCOC(=O)C(=O)OCC.
What is the InChIKey of diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate?
The InChIKey is OGBMMVFUNOWTKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5.C6H10O4.C6H12O2/c1-4-7(9(12)14-5-2)8(11)10(13)15-6-3;1-3-9-5(7)6(8)10-4-2;1-3-5-6(7)8-4-2/h7H,4-6H2,1-3H3;3-4H2,1-2H3;3-5H2,1-2H3.
What are the key properties of diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate?
diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate has a molecular weight of 478.54 g/mol, XLogP of 2.17, 11 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-ethyl-3-oxobutanedioate;diethyl oxalate;ethyl butanoate is sourced from PubChem (CID 159983761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).