About 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene
1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene (PubChem CID 159983929) has the molecular formula C21H29FO2
and a molecular weight of 332.46 g/mol. Its IUPAC name is 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene.
Molecular Properties
| Compound Name | 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene |
| PubChem CID | 159983929 |
| Molecular Formula | C21H29FO2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene |
| SMILES | COCCC(C)c1ccc(F)cc1.COCCCc1ccccc1 |
| InChI | InChI=1S/C11H15FO.C10H14O/c1-9(7-8-13-2)10-3-5-11(12)6-4-10;1-11-9-5-8-10-6-3-2-4-7-10/h3-6,9H,7-8H2,1-2H3;2-4,6-7H,5,8-9H2,1H3 |
| InChIKey | OGCALGXMJRTLQD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene?
The IUPAC name of 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene (CID 159983929) is 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene.
What is the SMILES notation for 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene?
The canonical SMILES for 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene is COCCC(C)c1ccc(F)cc1.COCCCc1ccccc1.
What is the InChIKey of 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene?
The InChIKey is OGCALGXMJRTLQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FO.C10H14O/c1-9(7-8-13-2)10-3-5-11(12)6-4-10;1-11-9-5-8-10-6-3-2-4-7-10/h3-6,9H,7-8H2,1-2H3;2-4,6-7H,5,8-9H2,1H3.
What are the key properties of 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene?
1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene has a molecular weight of 332.46 g/mol, XLogP of 5.23, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-(4-methoxybutan-2-yl)benzene;3-methoxypropylbenzene is sourced from PubChem (CID 159983929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).