C27H36N2O2 — CID 159984300
1-[(1R,5S)-9-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-4H-quinoline-2,3-dione (PubChem CID 159984300) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 1-[(1R,5S)-9-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-4H-quinoline-2,3-dione.
| Compound Name | 1-[(1R,5S)-9-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-4H-quinoline-2,3-dione |
|---|---|
| PubChem CID | 159984300 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 1-[(1R,5S)-9-[(1S,6R)-8-bicyclo[4.3.1]decanyl]-9-azabicyclo[3.3.1]nonan-3-yl]-4H-quinoline-2,3-dione |
| SMILES | O=C1Cc2ccccc2N(C2C[C@H]3CCC[C@@H](C2)N3C2C[C@H]3CCCC[C@@H](C2)C3)C1=O |
| InChI | InChI=1S/C27H36N2O2/c30-26-15-20-8-3-4-11-25(20)29(27(26)31)24-16-21-9-5-10-22(17-24)28(21)23-13-18-6-1-2-7-19(12-18)14-23/h3-4,8,11,18-19,21-24H,1-2,5-7,9-10,12-17H2/t18-,19+,21-,22+,23?,24? |
| InChIKey | BFXIAMQLIIHHAG-YACTVDJISA-N |
| XLogP | 4.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|