C34H36FN3O3 — CID 159987703
4-(benzylamino)-N-cyclopropyl-6-[3-fluoro-4-(4-oxoheptan-2-yl)phenyl]-7-(hydroxymethyl)quinoline-3-carboxamide (PubChem CID 159987703) has the molecular formula C34H36FN3O3 and a molecular weight of 553.68 g/mol. Its IUPAC name is 4-(benzylamino)-N-cyclopropyl-6-[3-fluoro-4-(4-oxoheptan-2-yl)phenyl]-7-(hydroxymethyl)quinoline-3-carboxamide.
| Compound Name | 4-(benzylamino)-N-cyclopropyl-6-[3-fluoro-4-(4-oxoheptan-2-yl)phenyl]-7-(hydroxymethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 159987703 |
| Molecular Formula | C34H36FN3O3 |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 4-(benzylamino)-N-cyclopropyl-6-[3-fluoro-4-(4-oxoheptan-2-yl)phenyl]-7-(hydroxymethyl)quinoline-3-carboxamide |
| SMILES | CCCC(=O)CC(C)c1ccc(-c2cc3c(NCc4ccccc4)c(C(=O)NC4CC4)cnc3cc2CO)cc1F |
| InChI | InChI=1S/C34H36FN3O3/c1-3-7-26(40)14-21(2)27-13-10-23(15-31(27)35)28-17-29-32(16-24(28)20-39)36-19-30(34(41)38-25-11-12-25)33(29)37-18-22-8-5-4-6-9-22/h4-6,8-10,13,15-17,19,21,25,39H,3,7,11-12,14,18,20H2,1-2H3,(H,36,37)(H,38,41) |
| InChIKey | UYKQICQLJFSNRC-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |