About 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid
3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid (PubChem CID 159988140) has the molecular formula C18H12ClF2NO4S
and a molecular weight of 411.81 g/mol. Its IUPAC name is 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid |
| PubChem CID | 159988140 |
| Molecular Formula | C18H12ClF2NO4S |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid |
| SMILES | Cc1ccc(Cl)c2c(COc3c(F)cc(C(N)=O)cc3F)c(C(=O)O)sc12 |
| InChI | InChI=1S/C18H12ClF2NO4S/c1-7-2-3-10(19)13-9(16(18(24)25)27-15(7)13)6-26-14-11(20)4-8(17(22)23)5-12(14)21/h2-5H,6H2,1H3,(H2,22,23)(H,24,25) |
| InChIKey | OGPFRNYNXHWCRF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid?
The IUPAC name of 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid (CID 159988140) is 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid.
What is the SMILES notation for 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid?
The canonical SMILES for 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid is Cc1ccc(Cl)c2c(COc3c(F)cc(C(N)=O)cc3F)c(C(=O)O)sc12.
What is the InChIKey of 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid?
The InChIKey is OGPFRNYNXHWCRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClF2NO4S/c1-7-2-3-10(19)13-9(16(18(24)25)27-15(7)13)6-26-14-11(20)4-8(17(22)23)5-12(14)21/h2-5H,6H2,1H3,(H2,22,23)(H,24,25).
What are the key properties of 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid?
3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid has a molecular weight of 411.81 g/mol, XLogP of 4.52, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-carbamoyl-2,6-difluorophenoxy)methyl]-4-chloro-7-methyl-1-benzothiophene-2-carboxylic acid is sourced from PubChem (CID 159988140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).