About 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium
1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium (PubChem CID 15998887) has the molecular formula C12H15Cl3N3+
and a molecular weight of 307.63 g/mol. Its IUPAC name is 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium.
Molecular Properties
| Compound Name | 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium |
| PubChem CID | 15998887 |
| Molecular Formula | C12H15Cl3N3+ |
| Molecular Weight | 307.63 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium |
| SMILES | C[n+]1nn(CCCCC(Cl)(Cl)Cl)c2ccccc21 |
| InChI | InChI=1S/C12H15Cl3N3/c1-17-10-6-2-3-7-11(10)18(16-17)9-5-4-8-12(13,14)15/h2-3,6-7H,4-5,8-9H2,1H3/q+1 |
| InChIKey | QVVTXEHFRDIDLF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.63 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium?
The IUPAC name of 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium (CID 15998887) is 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium.
What is the SMILES notation for 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium?
The canonical SMILES for 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium is C[n+]1nn(CCCCC(Cl)(Cl)Cl)c2ccccc21.
What is the InChIKey of 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium?
The InChIKey is QVVTXEHFRDIDLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl3N3/c1-17-10-6-2-3-7-11(10)18(16-17)9-5-4-8-12(13,14)15/h2-3,6-7H,4-5,8-9H2,1H3/q+1.
What are the key properties of 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium?
1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium has a molecular weight of 307.63 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(5,5,5-trichloropentyl)benzotriazol-1-ium is sourced from PubChem (CID 15998887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).