C90H78 — CID 159989341
3,8-bis(2,6-ditert-butylnaphthalen-1-yl)fluoranthene;2-(7-phenanthren-2-ylnaphthalen-2-yl)phenanthrene (PubChem CID 159989341) has the molecular formula C90H78 and a molecular weight of 1159.61 g/mol. Its IUPAC name is 3,8-bis(2,6-ditert-butylnaphthalen-1-yl)fluoranthene;2-(7-phenanthren-2-ylnaphthalen-2-yl)phenanthrene.
| Compound Name | 3,8-bis(2,6-ditert-butylnaphthalen-1-yl)fluoranthene;2-(7-phenanthren-2-ylnaphthalen-2-yl)phenanthrene |
|---|---|
| PubChem CID | 159989341 |
| Molecular Formula | C90H78 |
| Molecular Weight | 1159.61 g/mol |
| Exact Mass | 1158.61 |
| IUPAC Name | 3,8-bis(2,6-ditert-butylnaphthalen-1-yl)fluoranthene;2-(7-phenanthren-2-ylnaphthalen-2-yl)phenanthrene |
| SMILES | CC(C)(C)c1ccc2c(-c3ccc4c(c3)-c3cccc5c(-c6c(C(C)(C)C)ccc7cc(C(C)(C)C)ccc67)ccc-4c35)c(C(C)(C)C)ccc2c1.c1ccc2c(c1)ccc1cc(-c3ccc4ccc(-c5ccc6c(ccc7ccccc76)c5)cc4c3)ccc12 |
| InChI | InChI=1S/C52H54.C38H24/c1-49(2,3)34-19-22-36-31(28-34)17-26-44(51(7,8)9)46(36)33-16-21-38-41-24-25-42(39-14-13-15-40(47(39)41)43(38)30-33)48-37-23-20-35(50(4,5)6)29-32(37)18-27-45(48)52(10,11)12;1-3-7-35-26(5-1)11-15-32-21-30(17-19-37(32)35)28-13-9-25-10-14-29(24-34(25)23-28)31-18-20-38-33(22-31)16-12-27-6-2-4-8-36(27)38/h13-30H,1-12H3;1-24H |
| InChIKey | OGTCVKQKJYBIEH-UHFFFAOYSA-N |
| XLogP | 26.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1159.61 |
| LogP ≤ 5 | 26.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|