C38H49F4N5O8 — CID 159990232
(2,3,5,6-tetrafluorophenyl) 3-[2-[2-[2-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 159990232) has the molecular formula C38H49F4N5O8 and a molecular weight of 779.83 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[2-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[2-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 159990232 |
| Molecular Formula | C38H49F4N5O8 |
| Molecular Weight | 779.83 g/mol |
| Exact Mass | 779.35 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[2-[2-[2-[3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)CCOCCOCCOCCOCCOCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C38H49F4N5O8/c1-2-3-10-30-46-35-36(26-8-4-5-9-29(26)45-38(35)43)47(30)14-7-6-13-44-31(48)11-15-50-17-19-52-21-23-54-24-22-53-20-18-51-16-12-32(49)55-37-33(41)27(39)25-28(40)34(37)42/h4-5,8-9,25H,2-3,6-7,10-24H2,1H3,(H2,43,45)(H,44,48) |
| InChIKey | HHPQLHGFBSUOFB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 158.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.83 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|