C10H21N3O2 — CID 159990566
3-methylpyrrolidin-2-one;1,1,3,3-tetramethylurea (PubChem CID 159990566) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-methylpyrrolidin-2-one;1,1,3,3-tetramethylurea.
| Compound Name | 3-methylpyrrolidin-2-one;1,1,3,3-tetramethylurea |
|---|---|
| PubChem CID | 159990566 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 3-methylpyrrolidin-2-one;1,1,3,3-tetramethylurea |
| SMILES | CC1CCNC1=O.CN(C)C(=O)N(C)C |
| InChI | InChI=1S/C5H12N2O.C5H9NO/c1-6(2)5(8)7(3)4;1-4-2-3-6-5(4)7/h1-4H3;4H,2-3H2,1H3,(H,6,7) |
| InChIKey | OGWXMSMMYFSRQT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |