C21H25BrN2O — CID 15999177
4-bromo-2-[4-(4-ethylphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol (PubChem CID 15999177) has the molecular formula C21H25BrN2O and a molecular weight of 401.35 g/mol. Its IUPAC name is 4-bromo-2-[4-(4-ethylphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol.
| Compound Name | 4-bromo-2-[4-(4-ethylphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
|---|---|
| PubChem CID | 15999177 |
| Molecular Formula | C21H25BrN2O |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-bromo-2-[4-(4-ethylphenyl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]phenol |
| SMILES | CCc1ccc(C2=NC(C(C)C)NC(c3cc(Br)ccc3O)C2)cc1 |
| InChI | InChI=1S/C21H25BrN2O/c1-4-14-5-7-15(8-6-14)18-12-19(24-21(23-18)13(2)3)17-11-16(22)9-10-20(17)25/h5-11,13,19,21,24-25H,4,12H2,1-3H3 |
| InChIKey | SGSSSPWKJGSXRN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|