C31H34BrN7 — CID 159991797
2-bromopyridine;4,5-dimethylbenzene-1,2-diamine;4,5-dimethyl-1-N,2-N-dipyridin-2-ylbenzene-1,2-diamine (PubChem CID 159991797) has the molecular formula C31H34BrN7 and a molecular weight of 584.57 g/mol. Its IUPAC name is 2-bromopyridine;4,5-dimethylbenzene-1,2-diamine;4,5-dimethyl-1-N,2-N-dipyridin-2-ylbenzene-1,2-diamine.
| Compound Name | 2-bromopyridine;4,5-dimethylbenzene-1,2-diamine;4,5-dimethyl-1-N,2-N-dipyridin-2-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 159991797 |
| Molecular Formula | C31H34BrN7 |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | 2-bromopyridine;4,5-dimethylbenzene-1,2-diamine;4,5-dimethyl-1-N,2-N-dipyridin-2-ylbenzene-1,2-diamine |
| SMILES | Brc1ccccn1.Cc1cc(N)c(N)cc1C.Cc1cc(Nc2ccccn2)c(Nc2ccccn2)cc1C |
| InChI | InChI=1S/C18H18N4.C8H12N2.C5H4BrN/c1-13-11-15(21-17-7-3-5-9-19-17)16(12-14(13)2)22-18-8-4-6-10-20-18;1-5-3-7(9)8(10)4-6(5)2;6-5-3-1-2-4-7-5/h3-12H,1-2H3,(H,19,21)(H,20,22);3-4H,9-10H2,1-2H3;1-4H |
| InChIKey | OHARBOYEDQFWFX-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|