C9H11F13O3Si3 — CID 159991867
4-(5,5,6,6,7,7,7-heptafluoroheptyl)-2,2-bis(trifluoromethyl)-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 159991867) has the molecular formula C9H11F13O3Si3 and a molecular weight of 498.42 g/mol. Its IUPAC name is 4-(5,5,6,6,7,7,7-heptafluoroheptyl)-2,2-bis(trifluoromethyl)-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 4-(5,5,6,6,7,7,7-heptafluoroheptyl)-2,2-bis(trifluoromethyl)-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 159991867 |
| Molecular Formula | C9H11F13O3Si3 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | 4-(5,5,6,6,7,7,7-heptafluoroheptyl)-2,2-bis(trifluoromethyl)-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)CCCC[SiH]1O[SiH2]O[Si](C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C9H11F13O3Si3/c10-5(11,6(12,13)7(14,15)16)3-1-2-4-27-23-26-24-28(25-27,8(17,18)19)9(20,21)22/h27H,1-4,26H2 |
| InChIKey | OHAXGHQTNRHQLX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|