About CID 159991882
CID 159991882 (PubChem CID 159991882) has the molecular formula C54H51BBrN2O10
and a molecular weight of 978.72 g/mol.
Molecular Properties
| Compound Name | CID 159991882 |
| PubChem CID | 159991882 |
| Molecular Formula | C54H51BBrN2O10 |
| Molecular Weight | 978.72 g/mol |
| Exact Mass | 977.28 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1cccc(-c2ccccc2Cn2c(C)c(C)c3cc(C(=O)O)ccc32)c1.CCOC(=O)c1cccc(O[B]O)c1.Cc1c(C)n(Cc2ccccc2Br)c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C27H25NO4.C18H16BrNO2.C9H10BO4/c1-4-32-27(31)21-10-7-9-19(14-21)23-11-6-5-8-22(23)16-28-18(3)17(2)24-15-20(26(29)30)12-13-25(24)28;1-11-12(2)20(10-14-5-3-4-6-16(14)19)17-8-7-13(18(21)22)9-15(11)17;1-2-13-9(11)7-4-3-5-8(6-7)14-10-12/h5-15H,4,16H2,1-3H3,(H,29,30);3-9H,10H2,1-2H3,(H,21,22);3-6,12H,2H2,1H3 |
| InChIKey | HUHSQQRPQDHMFC-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 166.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 68 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 978.72 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159991882 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159991882?
The IUPAC name of CID 159991882 (CID 159991882) is not available.
What is the SMILES notation for CID 159991882?
The canonical SMILES for CID 159991882 is CCOC(=O)c1cccc(-c2ccccc2Cn2c(C)c(C)c3cc(C(=O)O)ccc32)c1.CCOC(=O)c1cccc(O[B]O)c1.Cc1c(C)n(Cc2ccccc2Br)c2ccc(C(=O)O)cc12.
What is the InChIKey of CID 159991882?
The InChIKey is HUHSQQRPQDHMFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25NO4.C18H16BrNO2.C9H10BO4/c1-4-32-27(31)21-10-7-9-19(14-21)23-11-6-5-8-22(23)16-28-18(3)17(2)24-15-20(26(29)30)12-13-25(24)28;1-11-12(2)20(10-14-5-3-4-6-16(14)19)17-8-7-13(18(21)22)9-15(11)17;1-2-13-9(11)7-4-3-5-8(6-7)14-10-12/h5-15H,4,16H2,1-3H3,(H,29,30);3-9H,10H2,1-2H3,(H,21,22);3-6,12H,2H2,1H3.
What are the key properties of CID 159991882?
CID 159991882 has a molecular weight of 978.72 g/mol, XLogP of 11.38, 13 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159991882 is sourced from PubChem (CID 159991882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).