C23H22N2O5 — CID 159992821
(E)-but-2-enedioic acid;1-[2-(5-phenyl-1,2-oxazol-3-yl)phenyl]but-3-en-1-amine (PubChem CID 159992821) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[2-(5-phenyl-1,2-oxazol-3-yl)phenyl]but-3-en-1-amine.
| Compound Name | (E)-but-2-enedioic acid;1-[2-(5-phenyl-1,2-oxazol-3-yl)phenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 159992821 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[2-(5-phenyl-1,2-oxazol-3-yl)phenyl]but-3-en-1-amine |
| SMILES | C=CCC(N)c1ccccc1-c1cc(-c2ccccc2)on1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H18N2O.C4H4O4/c1-2-8-17(20)15-11-6-7-12-16(15)18-13-19(22-21-18)14-9-4-3-5-10-14;5-3(6)1-2-4(7)8/h2-7,9-13,17H,1,8,20H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | OHDVYSSPEBWBAX-WLHGVMLRSA-N |
| XLogP | 4.30 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|