About CID 159993073
CID 159993073 (PubChem CID 159993073) has the molecular formula C30H34BClN3O4P
and a molecular weight of 577.86 g/mol.
Molecular Properties
| Compound Name | CID 159993073 |
| PubChem CID | 159993073 |
| Molecular Formula | C30H34BClN3O4P |
| Molecular Weight | 577.86 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | — |
| SMILES | [B]C1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC(COP(=O)(Cl)N2CCN(C(C)=O)CC2)O1 |
| InChI | InChI=1S/C30H34BClN3O4P/c1-24(36)33-17-19-35(20-18-33)40(32,37)38-23-28-21-34(22-29(31)39-28)30(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-16,28-29H,17-23H2,1H3 |
| InChIKey | ONYVYXOWZIPHER-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 577.86 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 159993073 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159993073?
The IUPAC name of CID 159993073 (CID 159993073) is not available.
What is the SMILES notation for CID 159993073?
The canonical SMILES for CID 159993073 is [B]C1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC(COP(=O)(Cl)N2CCN(C(C)=O)CC2)O1.
What is the InChIKey of CID 159993073?
The InChIKey is ONYVYXOWZIPHER-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H34BClN3O4P/c1-24(36)33-17-19-35(20-18-33)40(32,37)38-23-28-21-34(22-29(31)39-28)30(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-16,28-29H,17-23H2,1H3.
What are the key properties of CID 159993073?
CID 159993073 has a molecular weight of 577.86 g/mol, XLogP of 4.70, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159993073 is sourced from PubChem (CID 159993073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).