C17H24ClN6+ — CID 159993273
4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-N-(1,5-dimethylpyridin-1-ium-3-yl)pyrimidin-2-amine;hydrochloride (PubChem CID 159993273) has the molecular formula C17H24ClN6+ and a molecular weight of 347.87 g/mol. Its IUPAC name is 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-N-(1,5-dimethylpyridin-1-ium-3-yl)pyrimidin-2-amine;hydrochloride.
| Compound Name | 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-N-(1,5-dimethylpyridin-1-ium-3-yl)pyrimidin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 159993273 |
| Molecular Formula | C17H24ClN6+ |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-N-(1,5-dimethylpyridin-1-ium-3-yl)pyrimidin-2-amine;hydrochloride |
| SMILES | Cc1cc(Nc2nccc(N3C[C@H]4CC[C@@H](C3)N4)n2)c[n+](C)c1.Cl |
| InChI | InChI=1S/C17H23N6.ClH/c1-12-7-15(9-22(2)8-12)20-17-18-6-5-16(21-17)23-10-13-3-4-14(11-23)19-13;/h5-9,13-14,19H,3-4,10-11H2,1-2H3,(H,18,20,21);1H/q+1;/t13-,14+; |
| InChIKey | DHEKRFAVDXMUDH-KAECKJJSSA-N |
| XLogP | 1.72 |
| TPSA | 56.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|