C13H22O — CID 159996708
4-tert-butyl-2,6,6-trimethylcyclohexa-1,3-dien-1-ol (PubChem CID 159996708) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-tert-butyl-2,6,6-trimethylcyclohexa-1,3-dien-1-ol.
| Compound Name | 4-tert-butyl-2,6,6-trimethylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 159996708 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 4-tert-butyl-2,6,6-trimethylcyclohexa-1,3-dien-1-ol |
| SMILES | CC1=C(O)C(C)(C)CC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C13H22O/c1-9-7-10(12(2,3)4)8-13(5,6)11(9)14/h7,14H,8H2,1-6H3 |
| InChIKey | KDBBVGVBXMKSET-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |