C23H25NO6 — CID 159999054
4-[(2R)-4-[(5S)-3-[(1S)-1-(4-formyloxyphenyl)ethyl]-2-oxo-1,3-oxazolidin-5-yl]butan-2-yl]benzoic acid (PubChem CID 159999054) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is 4-[(2R)-4-[(5S)-3-[(1S)-1-(4-formyloxyphenyl)ethyl]-2-oxo-1,3-oxazolidin-5-yl]butan-2-yl]benzoic acid.
| Compound Name | 4-[(2R)-4-[(5S)-3-[(1S)-1-(4-formyloxyphenyl)ethyl]-2-oxo-1,3-oxazolidin-5-yl]butan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 159999054 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-[(2R)-4-[(5S)-3-[(1S)-1-(4-formyloxyphenyl)ethyl]-2-oxo-1,3-oxazolidin-5-yl]butan-2-yl]benzoic acid |
| SMILES | C[C@H](CC[C@H]1CN([C@@H](C)c2ccc(OC=O)cc2)C(=O)O1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H25NO6/c1-15(17-4-6-19(7-5-17)22(26)27)3-10-21-13-24(23(28)30-21)16(2)18-8-11-20(12-9-18)29-14-25/h4-9,11-12,14-16,21H,3,10,13H2,1-2H3,(H,26,27)/t15-,16+,21+/m1/s1 |
| InChIKey | NLIRRKZYWZPZJP-XFQAVAEZSA-N |
| XLogP | 4.39 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|